|
CAS#: 31323-50-9 Product: 2-[(5S)-5-Propyldihydro-2(3H)-Furanylidene]-1,3-Cyclopentanedione No suppilers available for the product. |
| Name | 2-[(5S)-5-Propyldihydro-2(3H)-Furanylidene]-1,3-Cyclopentanedione |
|---|---|
| Synonyms | 1,3-Cyclo |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25 |
| CAS Registry Number | 31323-50-9 |
| SMILES | O=C1C(/C(=O)CC1)=C2/O[C@H](CC2)CCC |
| InChI | 1S/C12H16O3/c1-2-3-8-4-7-11(15-8)12-9(13)5-6-10(12)14/h8H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | AFHDYMGMZUYZQT-QMMMGPOBSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.596°C at 760 mmHg (Cal.) |
| Flash point | 150.662°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(5S)-5-Propyldihydro-2(3H)-Furanylidene]-1,3-Cyclopentanedione |