|
CAS#: 31383-55-8 Product: 2-(Methoxymethyl)-3-(2-Methylphenyl)-4(3H)-Quinazolinone No suppilers available for the product. |
| Name | 2-(Methoxymethyl)-3-(2-Methylphenyl)-4(3H)-Quinazolinone |
|---|---|
| Synonyms | 2-Methoxymethyl-3-(o-tolyl)-4(3H)-quinazolone; 4(3H)-Quinazolinone, 2-methoxymethyl-3-(o-tolyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.32 |
| CAS Registry Number | 31383-55-8 |
| SMILES | O=C1c3c(\N=C(/N1c2ccccc2C)COC)cccc3 |
| InChI | 1S/C17H16N2O2/c1-12-7-3-6-10-15(12)19-16(11-21-2)18-14-9-5-4-8-13(14)17(19)20/h3-10H,11H2,1-2H3 |
| InChIKey | QDRBPXRQVCYGCU-UHFFFAOYSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.356°C at 760 mmHg (Cal.) |
| Flash point | 212.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Methoxymethyl)-3-(2-Methylphenyl)-4(3H)-Quinazolinone |