|
CAS#: 31396-45-9 Product: Bis{4-[(Trimethylsilyl)Amino]Phenyl}Methanone No suppilers available for the product. |
| Name | Bis{4-[(Trimethylsilyl)Amino]Phenyl}Methanone |
|---|---|
| Synonyms | Bis(4-[(trimethylsilyl)amino]phenyl)methanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C19H28N2OSi2 |
| Molecular Weight | 356.61 |
| CAS Registry Number | 31396-45-9 |
| SMILES | O=C(c1ccc(N[Si](C)(C)C)cc1)c2ccc(N[Si](C)(C)C)cc2 |
| InChI | 1S/C19H28N2OSi2/c1-23(2,3)20-17-11-7-15(8-12-17)19(22)16-9-13-18(14-10-16)21-24(4,5)6/h7-14,20-21H,1-6H3 |
| InChIKey | ZBORRYKSHKEJID-UHFFFAOYSA-N |
| Density | 1.037g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.132°C at 760 mmHg (Cal.) |
| Flash point | 221.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis{4-[(Trimethylsilyl)Amino]Phenyl}Methanone |