|
CAS#: 31462-62-1 Product: 1,2,3,4,5,5,6,6-Octafluorobicyclo[2.2.2]Oct-2-Ene No suppilers available for the product. |
| Name | 1,2,3,4,5,5,6,6-Octafluorobicyclo[2.2.2]Oct-2-Ene |
|---|---|
| Synonyms | 1,2,3,4,5,5,6,6-Octafluorobicyclo[2.2.2]oct-2-ene # |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4F8 |
| Molecular Weight | 252.10 |
| CAS Registry Number | 31462-62-1 |
| SMILES | FC2(F)C1(F)C(\F)=C(\F)C(F)(CC1)C2(F)F |
| InChI | 1S/C8H4F8/c9-3-4(10)6(12)2-1-5(3,11)7(13,14)8(6,15)16/h1-2H2 |
| InChIKey | MILCJPLPEMJWKH-UHFFFAOYSA-N |
| Density | 1.578g/cm3 (Cal.) |
|---|---|
| Boiling point | 130.641°C at 760 mmHg (Cal.) |
| Flash point | 30.583°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,5,6,6-Octafluorobicyclo[2.2.2]Oct-2-Ene |