|
CAS#: 31551-02-7 Product: 2-methyl-2-Propenoic acid methyl ester, polymer with ethenylbenzene and 2-propenamide No suppilers available for the product. |
| Name | 2-methyl-2-Propenoic acid methyl ester, polymer with ethenylbenzene and 2-propenamide |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid Methyl Ester; Prop-2-Enamide; Styrene; Acrylamide; 2-Methylacrylic Acid Methyl Ester; Styrene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 |
| CAS Registry Number | 31551-02-7 |
| SMILES | CC(C(OC)=O)=C.O=C(N)C=C.C1=C(C=CC=C1)C=C |
| InChI | 1S/C8H8.C5H8O2.C3H5NO/c1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3;1-2-3(4)5/h2-7H,1H2;1H2,2-3H3;2H,1H2,(H2,4,5) |
| InChIKey | WGOHKAZPXXKHGK-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-methyl-2-Propenoic acid methyl ester, polymer with ethenylbenzene and 2-propenamide |