|
CAS#: 31634-70-5 Product: 1,6-Diphosphatriptycene No suppilers available for the product. |
| Name | 1,6-Diphosphatriptycene |
|---|---|
| Synonyms | 5,10-O-Benzenophosphanthrene; 5,10[1',2']-Benzenophosphanthrene; Nsc244345 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12P2 |
| Molecular Weight | 290.24 |
| CAS Registry Number | 31634-70-5 |
| SMILES | C1=CC2=C(C=C1)P3C5=C(P2C4=CC=CC=C34)C=CC=C5 |
| InChI | 1S/C18H12P2/c1-2-8-14-13(7-1)19-15-9-3-5-11-17(15)20(14)18-12-6-4-10-16(18)19/h1-12H |
| InChIKey | PZGACYAQZNGXGK-UHFFFAOYSA-N |
| Boiling point | 383.432°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 195.607°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Diphosphatriptycene |