|
CAS#: 31669-55-3 Product: Styrene, 1,3-butadiene, vinylidene chloride polymer No suppilers available for the product. |
| Name | Styrene, 1,3-butadiene, vinylidene chloride polymer |
|---|---|
| Synonyms | Buta-1,3-Diene; 1,1-Dichloroethylene; Styrene; Buta-1,3-Diene; 1,1-Dichloroethene; Ethenylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16Cl2 |
| Molecular Weight | 255.19 |
| CAS Registry Number | 31669-55-3 |
| SMILES | C(Cl)(Cl)=C.C1=C(C=CC=C1)C=C.C(C=C)=C |
| InChI | 1S/C8H8.C4H6.C2H2Cl2/c1-2-8-6-4-3-5-7-8;1-3-4-2;1-2(3)4/h2-7H,1H2;3-4H,1-2H2;1H2 |
| InChIKey | NULPNBOHNGRVJF-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Styrene, 1,3-butadiene, vinylidene chloride polymer |