|
CAS#: 31724-37-5 Product: Tyrosine No suppilers available for the product. |
| Name | Tyrosine |
|---|---|
| Synonyms | (-)-α-Amino-p-hydroxyhydrocinnamic acid; (±)-Tyrosine; (S)-tyrosine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 31724-37-5 |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |
| InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
| InChIKey | OUYCCCASQSFEME-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 300°C (Expl.) |
| Boiling point | 385.2±32.0°C at 760 mmHg (Cal.) |
| Flash point | 186.7±25.1°C (Cal.) |
| Safety Description | Minimize contact. |
|---|---|
| WARNING: Irritates lungs, eyes, skin | |
| (1) | Vanessa Incani, Afsaneh Lavasanifar and Hasan Uludağ. Lipid and hydrophobic modification of cationic carriers on route to superior gene vectors, Soft Matter, 2010, 6, 2124. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tyrosine |