|
CAS#: 31755-23-4 Product: (1-Tert-Butylpiperidin-3-Yl) N-(2,6-Dimethylphenyl)Carbamate No suppilers available for the product. |
| Name | (1-Tert-Butylpiperidin-3-Yl) N-(2,6-Dimethylphenyl)Carbamate |
|---|---|
| Synonyms | (1-Tert-Butyl-3-Piperidyl) N-(2,6-Dimethylphenyl)Carbamate; N-(2,6-Dimethylphenyl)Carbamic Acid (1-Tert-Butyl-3-Piperidinyl) Ester; N-(2,6-Dimethylphenyl)Carbamic Acid (1-Tert-Butyl-3-Piperidyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 |
| CAS Registry Number | 31755-23-4 |
| SMILES | C1=C(C(=C(C=C1)C)NC(OC2CN(CCC2)C(C)(C)C)=O)C |
| InChI | 1S/C18H28N2O2/c1-13-8-6-9-14(2)16(13)19-17(21)22-15-10-7-11-20(12-15)18(3,4)5/h6,8-9,15H,7,10-12H2,1-5H3,(H,19,21) |
| InChIKey | GNWFVFIRKIFSPN-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.824°C at 760 mmHg (Cal.) |
| Flash point | 175.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Tert-Butylpiperidin-3-Yl) N-(2,6-Dimethylphenyl)Carbamate |