|
CAS#: 31775-17-4 Product: 2,2'-[(3,3'-Dichloro-4,4'-Biphenyldiyl)Di-2,1-Diazenediyl]Bis[N-(2-Ethoxyphenyl)-3-Oxobutanamide] No suppilers available for the product. |
| Name | 2,2'-[(3,3'-Dichloro-4,4'-Biphenyldiyl)Di-2,1-Diazenediyl]Bis[N-(2-Ethoxyphenyl)-3-Oxobutanamide] |
|---|---|
| Synonyms | 2,2'-[(3, |
| Molecular Structure | ![]() |
| Molecular Formula | C36H34Cl2N6O6 |
| Molecular Weight | 717.60 |
| CAS Registry Number | 31775-17-4 |
| EINECS | 250-798-1 |
| SMILES | Clc2cc(ccc2N=NC(C(C)=O)C(=O)Nc1ccccc1OCC)c4ccc(N=NC(C(C)=O)C(=O)Nc3ccccc3OCC)c(Cl)c4 |
| InChI | 1S/C36H34Cl2N6O6/c1-5-49-31-13-9-7-11-29(31)39-35(47)33(21(3)45)43-41-27-17-15-23(19-25(27)37)24-16-18-28(26(38)20-24)42-44-34(22(4)46)36(48)40-30-12-8-10-14-32(30)50-6-2/h7-20,33-34H,5-6H2,1-4H3,(H,39,47)(H,40,48) |
| InChIKey | LJUPKWWNSAQNRV-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 820.611°C at 760 mmHg (Cal.) |
| Flash point | 450.089°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-[(3,3'-Dichloro-4,4'-Biphenyldiyl)Di-2,1-Diazenediyl]Bis[N-(2-Ethoxyphenyl)-3-Oxobutanamide] |