|
CAS#: 31805-53-5 Product: 5-(2-Chloroethyl)-4-methyl-2-phenylthiazole ethanedisulfonate (2:1) No suppilers available for the product. |
| Name | 5-(2-Chloroethyl)-4-methyl-2-phenylthiazole ethanedisulfonate (2:1) |
|---|---|
| Synonyms | 5-(2-Chloroethyl)-4-Methyl-2-Phenyl-Thiazole; 5-(2-Chloroethyl)-4-Methyl-2-Phenyl-Thiazole; Ethane-1,2-Disulfonic Acid; 5-(2-Chloroethyl)-4-Methyl-2-Phenylthiazole; 5-(2-Chloroethyl)-4-Methyl-2-Phenylthiazole; Ethane-1,2-Disulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C26H30Cl2N2O6S4 |
| Molecular Weight | 665.68 |
| CAS Registry Number | 31805-53-5 |
| SMILES | C2=C(C1=NC(=C(S1)CCCl)C)C=CC=C2.C4=C(C3=NC(=C(S3)CCCl)C)C=CC=C4.C([S](=O)(=O)O)C[S](=O)(=O)O |
| InChI | 1S/2C12H12ClNS.C2H6O6S2/c2*1-9-11(7-8-13)15-12(14-9)10-5-3-2-4-6-10;3-9(4,5)1-2-10(6,7)8/h2*2-6H,7-8H2,1H3;1-2H2,(H,3,4,5)(H,6,7,8) |
| InChIKey | QISDTLRXHVGGDY-UHFFFAOYSA-N |
| Boiling point | 379.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 183.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2-Chloroethyl)-4-methyl-2-phenylthiazole ethanedisulfonate (2:1) |