|
CAS#: 31858-09-0 Product: Tris(2-Bromopropyl) Phosphate No suppilers available for the product. |
| Name | Tris(2-Bromopropyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Tris(2-Bromopropyl) Ester; 1-Propanol, 2-Bromo-, Phosphate (3:1); Tris(2-Bromopropyl)Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18Br3O4P |
| Molecular Weight | 460.92 |
| CAS Registry Number | 31858-09-0 |
| SMILES | C(C(Br)C)O[P](=O)(OCC(Br)C)OCC(Br)C |
| InChI | 1S/C9H18Br3O4P/c1-7(10)4-14-17(13,15-5-8(2)11)16-6-9(3)12/h7-9H,4-6H2,1-3H3 |
| InChIKey | ZGSVOKGHZCGQGM-UHFFFAOYSA-N |
| Density | 1.766g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.225°C at 760 mmHg (Cal.) |
| Flash point | 195.244°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(2-Bromopropyl) Phosphate |