Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1-(3-Aminopropyl)Adamantane Hydrochloride |
|---|---|
| Synonyms | 3-(1-Adamantyl)Propylamine Hydrochloride; Adamantane, 1-(3-Aminopropyl)-, Hydrochloride; Propylamine, 3-(1-Adamantyl)-, Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C13H24ClN |
| Molecular Weight | 229.79 |
| CAS Registry Number | 31897-98-0 |
| SMILES | [H+].C(C12CC3CC(C1)CC(C2)C3)CCN.[Cl-] |
| InChI | 1S/C13H23N.ClH/c14-3-1-2-13-7-10-4-11(8-13)6-12(5-10)9-13;/h10-12H,1-9,14H2;1H |
| InChIKey | KWASCACKNUFQKQ-UHFFFAOYSA-N |
| Boiling point | 265.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Aminopropyl)Adamantane Hydrochloride |