|
CAS#: 319-23-3 Product: Anthra[2,3-b]Carbazole No suppilers available for the product. |
| Name | Anthra[2,3-b]Carbazole |
|---|---|
| Synonyms | Anthra(2,3-B)Carbazole |
| Molecular Structure | ![]() |
| Molecular Formula | C24H15N |
| Molecular Weight | 317.39 |
| CAS Registry Number | 319-23-3 |
| SMILES | C1=C4C(=CC2=C1[NH]C3=CC=CC=C23)C=C5C(=C4)C=C6C(=C5)C=CC=C6 |
| InChI | 1S/C24H15N/c1-2-6-16-10-18-12-20-14-24-22(21-7-3-4-8-23(21)25-24)13-19(20)11-17(18)9-15(16)5-1/h1-14,25H |
| InChIKey | AEVNDWITFKNVRU-UHFFFAOYSA-N |
| Density | 1.332g/cm3 (Cal.) |
|---|---|
| Boiling point | 623.358°C at 760 mmHg (Cal.) |
| Flash point | 279.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Anthra[2,3-b]Carbazole |