|
CAS#: 31976-47-3 Product: 1,3-Isobenzofurandione, polymer with 1,2-propanediol No suppilers available for the product. |
| Name | 1,3-Isobenzofurandione, polymer with 1,2-propanediol |
|---|---|
| Synonyms | Isobenzofuran-1,3-Dione; Propane-1,2-Diol; Isobenzofuran-1,3-Quinone; Propane-1,2-Diol; (Phthalic Anhydride-1,2-Propylene Glycol) Polymer |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 |
| CAS Registry Number | 31976-47-3 |
| SMILES | C1=CC=CC2=C1C(OC2=O)=O.C(O)C(O)C |
| InChI | 1S/C8H4O3.C3H8O2/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-3(5)2-4/h1-4H;3-5H,2H2,1H3 |
| InChIKey | AXJSIQGHQGNFQA-UHFFFAOYSA-N |
| Boiling point | 295°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 139.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Isobenzofurandione, polymer with 1,2-propanediol |