Online Database of Chemicals from Around the World
|
CAS#: 31992-00-4 Product: 1,6-Dimethyl-3-Phenyl-5-(Propan-2-Ylamino)Pyrimidine-2,4-Dione No suppilers available for the product. |
| Name | 1,6-Dimethyl-3-Phenyl-5-(Propan-2-Ylamino)Pyrimidine-2,4-Dione |
|---|---|
| Synonyms | 5-(Isopropylamino)-1,6-Dimethyl-3-Phenyl-Pyrimidine-2,4-Dione; 5-(Isopropylamino)-1,6-Dimethyl-3-Phenylpyrimidine-2,4-Dione; 5-(Isopropylamino)-1,6-Dimethyl-3-Phenyl-Pyrimidine-2,4-Quinone |
| Molecular Structure |  |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.33 |
| CAS Registry Number | 31992-00-4 |
| SMILES | C2=C(N1C(=O)C(=C(N(C1=O)C)C)NC(C)C)C=CC=C2 |
| InChI | 1S/C15H19N3O2/c1-10(2)16-13-11(3)17(4)15(20)18(14(13)19)12-8-6-5-7-9-12/h5-10,16H,1-4H3 |
| InChIKey | VVNYZYBWULAGJY-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.057°C at 760 mmHg (Cal.) |
| Flash point | 189.095°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dimethyl-3-Phenyl-5-(Propan-2-Ylamino)Pyrimidine-2,4-Dione |