|
CAS#: 32047-74-8 Product: 5,11-Dimethyl-6H-Benzo[c][1,5]Benzodiazepine No suppilers available for the product. |
| Name | 5,11-Dimethyl-6H-Benzo[c][1,5]Benzodiazepine |
|---|---|
| Synonyms | 5,10-Dimethyl-10,11-Dihydro-5H-Dibenzo(B,E)(1,4)Diazepine; 5H-Dibenzo(B,E)(1,4)Diazepine, 10,11-Dihydro-5,10-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.30 |
| CAS Registry Number | 32047-74-8 |
| SMILES | C1=CC=CC2=C1N(C3=C(CN2C)C=CC=C3)C |
| InChI | 1S/C15H16N2/c1-16-11-12-7-3-4-8-13(12)17(2)15-10-6-5-9-14(15)16/h3-10H,11H2,1-2H3 |
| InChIKey | ISNMCLQAHBYOKS-UHFFFAOYSA-N |
| Density | 1.089g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.086°C at 760 mmHg (Cal.) |
| Flash point | 162.59°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,11-Dimethyl-6H-Benzo[c][1,5]Benzodiazepine |