| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl N,N-Bis(Ethoxycarbonyl)Carbamate |
|---|---|
| Synonyms | N,N-Bis(Ethoxycarbonyl)Carbamic Acid Ethyl Ester; N,N-Dicarbethoxycarbamic Acid Ethyl Ester; Nsc65656 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 |
| CAS Registry Number | 3206-31-3 |
| EINECS | 221-709-3 |
| SMILES | C(OC(N(C(OCC)=O)C(OCC)=O)=O)C |
| InChI | 1S/C9H15NO6/c1-4-14-7(11)10(8(12)15-5-2)9(13)16-6-3/h4-6H2,1-3H3 |
| InChIKey | WMXDFLUIDJYHMF-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.266°C at 760 mmHg (Cal.) |
| Flash point | 122.696°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N,N-Bis(Ethoxycarbonyl)Carbamate |