|
CAS#: 32074-74-1 Product: 2,2'-Disulfanediylbis[4-(2-Methyl-2-Butanyl)Phenol] No suppilers available for the product. |
| Name | 2,2'-Disulfanediylbis[4-(2-Methyl-2-Butanyl)Phenol] |
|---|---|
| Synonyms | dithiobis[4-(1,1-dimethylpropyl)phenol] |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30O2S2 |
| Molecular Weight | 390.60 |
| CAS Registry Number | 32074-74-1 |
| EINECS | 250-915-6 |
| SMILES | CC(C)(CC)c2cc(SSc1cc(ccc1O)C(C)(C)CC)c(O)cc2 |
| InChI | 1S/C22H30O2S2/c1-7-21(3,4)15-9-11-17(23)19(13-15)25-26-20-14-16(10-12-18(20)24)22(5,6)8-2/h9-14,23-24H,7-8H2,1-6H3 |
| InChIKey | RZAPFEWZXAKCHZ-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.698°C at 760 mmHg (Cal.) |
| Flash point | 233.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Disulfanediylbis[4-(2-Methyl-2-Butanyl)Phenol] |