|
CAS#: 3209-37-8 Product: Oxiran-2-Ylmethyl 4-Ethenylbenzoate No suppilers available for the product. |
| Name | Oxiran-2-Ylmethyl 4-Ethenylbenzoate |
|---|---|
| Synonyms | Oxiran-2-Ylmethyl 4-Vinylbenzoate; 4-Vinylbenzoic Acid 2-Oxiranylmethyl Ester; 4-Vinylbenzoic Acid Glycidyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 |
| CAS Registry Number | 3209-37-8 |
| EINECS | 221-719-8 |
| SMILES | C2=C(C(OCC1OC1)=O)C=CC(=C2)C=C |
| InChI | 1S/C12H12O3/c1-2-9-3-5-10(6-4-9)12(13)15-8-11-7-14-11/h2-6,11H,1,7-8H2 |
| InChIKey | JFHBKKGEVRVZPE-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Oxiran-2-Ylmethyl 4-Ethenylbenzoate |