|
CAS#: 32142-08-8 Product: 2-[(1S,3S,4S)-3-Isopropenyl-4-Methyl-4-Vinylcyclohexyl]-2-Propanol No suppilers available for the product. |
| Name | 2-[(1S,3S,4S)-3-Isopropenyl-4-Methyl-4-Vinylcyclohexyl]-2-Propanol |
|---|---|
| Synonyms | β-elemol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 |
| CAS Registry Number | 32142-08-8 |
| SMILES | OC(C)(C)[C@@H]1C[C@@H](C(C)=C)[C@](C)(C=C)CC1 |
| InChI | 1S/C15H26O/c1-7-15(6)9-8-12(14(4,5)16)10-13(15)11(2)3/h7,12-13,16H,1-2,8-10H2,3-6H3/t12-,13-,15+/m0/s1 |
| InChIKey | GFJIQNADMLPFOW-KCQAQPDRSA-N |
| Density | 0.932g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.567°C at 760 mmHg (Cal.) |
| Flash point | 98.912°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(1S,3S,4S)-3-Isopropenyl-4-Methyl-4-Vinylcyclohexyl]-2-Propanol |