|
CAS#: 32164-26-4 Product: 24-Deoxy-streptovaricinoic acid methyl ester No suppilers available for the product. |
| Name | 24-Deoxy-streptovaricinoic acid methyl ester |
|---|---|
| Synonyms | Methyl 24-Deoxystreptovaricinoate; Nsc 156216; Nsc 189796 |
| Molecular Structure | ![]() |
| Molecular Formula | C40H51NO13 |
| Molecular Weight | 753.84 |
| CAS Registry Number | 32164-26-4 |
| SMILES | [C@@H]1([C@H](O)[C@@H]([C@@H](O)[C@@H](C)\C=C(C4=C3C2=C(OC(=O)C)C(=C(NC(=O)C(=C\C=C/[C@H](C(O)[C@H]([C@H]1O)C)C)\C)C(=O)C2=C(O)C(=C3OCO4)C)C)/C)C)C(OC)=O |
| InChI | 1S/C40H51NO13/c1-16-12-11-13-17(2)39(49)41-29-20(5)38(54-24(9)42)25-26(35(29)48)34(47)23(8)37-27(25)36(52-15-53-37)19(4)14-18(3)31(44)22(7)33(46)28(40(50)51-10)32(45)21(6)30(16)43/h11-14,16,18,21-22,28,30-33,43-47H,15H2,1-10H3,(H,41,49)/b12-11-,17-13+,19-14+/t16-,18+,21-,22-,28-,30?,31+,32-,33-/m1/s1 |
| InChIKey | HELVNXXGIWPNLD-JIZKLWPASA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 931.6±65.0°C at 760 mmHg (Cal.) |
| Flash point | 517.2±34.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 24-Deoxy-streptovaricinoic acid methyl ester |