|
CAS#: 32213-88-0 Product: 1,3,4,5,6,7-Hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl acetate No suppilers available for the product. |
| Name | 1,3,4,5,6,7-Hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl acetate |
|---|---|
| Synonyms | 1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-2H-2,4A-Methanonaphthalen-7-Yl Acetate; 2H-2,4A-Methanonaphthalen-7-Ol, 1,3,4,5,6,7-Hexahydro-1,1,5,5-Tetramethyl-, Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 |
| CAS Registry Number | 32213-88-0 |
| EINECS | 250-955-4 |
| SMILES | CC2(C1CC3(CC1)C(CC(OC(=O)C)C=C23)(C)C)C |
| InChI | 1S/C17H26O2/c1-11(18)19-13-8-14-16(4,5)12-6-7-17(14,9-12)15(2,3)10-13/h8,12-13H,6-7,9-10H2,1-5H3 |
| InChIKey | DMRSABXLZDPVFE-UHFFFAOYSA-N |
| Density | 1.045g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.438°C at 760 mmHg (Cal.) |
| Flash point | 144.974°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,4,5,6,7-Hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl acetate |