|
CAS#: 32235-06-6 Product: 6-Methoxytricyclo[6.2.1.02,7]Undeca-5,9-Diene-3,4-Dione No suppilers available for the product. |
| Name | 6-Methoxytricyclo[6.2.1.02,7]Undeca-5,9-Diene-3,4-Dione |
|---|---|
| Synonyms | 8-methoxy |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 |
| CAS Registry Number | 32235-06-6 |
| SMILES | COC1=CC(=O)C(=O)C2C1C3CC2C=C3 |
| InChI | 1S/C12H12O3/c1-15-9-5-8(13)12(14)11-7-3-2-6(4-7)10(9)11/h2-3,5-7,10-11H,4H2,1H3 |
| InChIKey | NCIHZOMMBOXFDM-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.75°C at 760 mmHg (Cal.) |
| Flash point | 160.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxytricyclo[6.2.1.02,7]Undeca-5,9-Diene-3,4-Dione |