|
CAS#: 32303-26-7 Product: lantanolic acid No suppilers available for the product. |
| Name | lantanolic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 |
| CAS Registry Number | 32303-26-7 |
| SMILES | [C@]26(C(=CC[C@@H]3C14CO[C@](C([C@@H]1CC[C@@]23C)(C)C)(O)CC4)[C@@H]5CC(C)(C)CC[C@@]5(CC6)C(=O)O)C |
| InChI | 1S/C30H46O4/c1-24(2)11-13-28(23(31)32)14-12-26(5)19(20(28)17-24)7-8-22-27(26,6)10-9-21-25(3,4)30(33)16-15-29(21,22)18-34-30/h7,20-22,33H,8-18H2,1-6H3,(H,31,32)/t20-,21-,22-,26+,27+,28-,29?,30+/m0/s1 |
| InChIKey | UFVGYQQCHANGSN-MRNMRUPFSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 582.83°C at 760 mmHg (Cal.) |
| Flash point | 184.132°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for lantanolic acid |