| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,4-Dichlorophenoxyacetic acid triisopropanolamine salt |
|---|---|
| Synonyms | 1-(Bis(2-Hydroxypropyl)Amino)Propan-2-Ol; 2-(2,4-Dichlorophenoxy)Ethanoic Acid; 2-Propanol, 1,1',1''-Nitrilotris-, (2,4-Dichlorophenoxy)Acetate (Salt); Acetic Acid, (2,4-Dichlorophenoxy)-, Compd. With 1,1',1''-Nitrilotri-2-Propanol (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C17H27Cl2NO6 |
| Molecular Weight | 412.31 |
| CAS Registry Number | 32341-80-3 |
| SMILES | C1=CC(=CC(=C1OCC(=O)O)Cl)Cl.C(C(C)O)N(CC(C)O)CC(C)O |
| InChI | 1S/C9H21NO3.C8H6Cl2O3/c1-7(11)4-10(5-8(2)12)6-9(3)13;9-5-1-2-7(6(10)3-5)13-4-8(11)12/h7-9,11-13H,4-6H2,1-3H3;1-3H,4H2,(H,11,12) |
| InChIKey | SRPJGPPDQIFOGY-UHFFFAOYSA-N |
| Boiling point | 296.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 167°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichlorophenoxyacetic acid triisopropanolamine salt |