|
CAS#: 32362-68-8 Product: 6,11-Dimethylnaphtho[3,2-b][1]Benzothiole No suppilers available for the product. |
| Name | 6,11-Dimethylnaphtho[3,2-b][1]Benzothiole |
|---|---|
| Synonyms | 6,11-Dimethylnaphtho[3,2-B]Benzothiophene; 6,11-Dimethylbenzo(B)Naphtho(2,3-D)Thiophene; Benzo(B)Naphtho(2,3-D)Thiophene, 6,11-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14S |
| Molecular Weight | 262.37 |
| CAS Registry Number | 32362-68-8 |
| SMILES | C2=C1C(=C4C(=C(C1=CC=C2)C)C3=CC=CC=C3S4)C |
| InChI | 1S/C18H14S/c1-11-13-7-3-4-8-14(13)12(2)18-17(11)15-9-5-6-10-16(15)19-18/h3-10H,1-2H3 |
| InChIKey | WOFSBEKGNNEKRM-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.262°C at 760 mmHg (Cal.) |
| Flash point | 175.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,11-Dimethylnaphtho[3,2-b][1]Benzothiole |