|
CAS#: 3239-63-2 Product: Methyl-(Phenoxy)-Propylsulfanyl-Sulfanylidenephosphorane No suppilers available for the product. |
| Name | Methyl-(Phenoxy)-Propylsulfanyl-Sulfanylidenephosphorane |
|---|---|
| Synonyms | Methyl-(Phenoxy)-Propylsulfanyl-Thioxo-Phosphorane; Methyl-(Phenoxy)-(Propylthio)-Thioxophosphorane; Methyl-(Phenoxy)-(Propylthio)-Thioxo-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15OPS2 |
| Molecular Weight | 246.32 |
| CAS Registry Number | 3239-63-2 |
| SMILES | C1=C(O[P](=S)(SCCC)C)C=CC=C1 |
| InChI | 1S/C10H15OPS2/c1-3-9-14-12(2,13)11-10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3 |
| InChIKey | WGAOJKBMFUUZJC-UHFFFAOYSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.651°C at 760 mmHg (Cal.) |
| Flash point | 149.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl-(Phenoxy)-Propylsulfanyl-Sulfanylidenephosphorane |