Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | N-Acetyl-3,4,5-Trifluorophenylalanine |
|---|---|
| Synonyms | "2-AcetylAmino-3-(3,4,5-trifluoro-phenyl)-propionic acid"; 2-Acetamido-3-(3,4,5-trifluorophenyl)propanoic acid; 2-Acetylamino-3-(3,4,5-trifluoro-phenyl)-propanoic acid |
| Molecular Structure |  |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 |
| CAS Registry Number | 324028-18-4 |
| SMILES | Fc1cc(CC(NC(C)=O)C(O)=O)cc(F)c1F |
| InChI | 1S/C11H10F3NO3/c1-5(16)15-9(11(17)18)4-6-2-7(12)10(14)8(13)3-6/h2-3,9H,4H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | MJBCGFLRYSZAPQ-UHFFFAOYSA-N |
| Density | 1.409g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.659°C at 760 mmHg (Cal.) |
| Flash point | 223.931°C (Cal.) |
| Refractive index | 1.503 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-3,4,5-Trifluorophenylalanine |