|
CAS#: 3247-34-5 Product: Disodium 3,4,6-Trichloro-2-[(2,3,5-Trichloro-6-Oxidophenyl)Methyl]Phenolate No suppilers available for the product. |
| Name | Disodium 3,4,6-Trichloro-2-[(2,3,5-Trichloro-6-Oxidophenyl)Methyl]Phenolate |
|---|---|
| Synonyms | Disodium 3,4,6-Trichloro-2-[(2,3,5-Trichloro-6-Oxido-Phenyl)Methyl]Phenolate; Disodium 3,4,6-Trichloro-2-(2,3,5-Trichloro-6-Oxido-Benzyl)Phenolate; Phenol, 2,2'-Methylenebis(3,4,6-Trichloro-, Disodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C13H4Cl6Na2O2 |
| Molecular Weight | 450.87 |
| CAS Registry Number | 3247-34-5 |
| EINECS | 221-824-9 |
| SMILES | C1=C(Cl)C(=C(C(=C1Cl)Cl)CC2=C(Cl)C(=CC(=C2[O-])Cl)Cl)[O-].[Na+].[Na+] |
| InChI | 1S/C13H6Cl6O2.2Na/c14-6-2-8(16)12(20)4(10(6)18)1-5-11(19)7(15)3-9(17)13(5)21;;/h2-3,20-21H,1H2;;/q;2*+1/p-2 |
| InChIKey | UQWJZQUQIILWBP-UHFFFAOYSA-L |
| Boiling point | 470.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 238.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium 3,4,6-Trichloro-2-[(2,3,5-Trichloro-6-Oxidophenyl)Methyl]Phenolate |