|
CAS#: 3247-65-2 Product: 4-Ethyl-1,1-Dimethyl-6-(2-Methyl-2-Propanyl)Indane No suppilers available for the product. |
| Name | 4-Ethyl-1,1-Dimethyl-6-(2-Methyl-2-Propanyl)Indane |
|---|---|
| Synonyms | 6-tert-Butyl-4-ethyl-1,1-dimethylindane # |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 |
| CAS Registry Number | 3247-65-2 |
| SMILES | c1(cc(cc2c1CCC2(C)C)C(C)(C)C)CC |
| InChI | 1S/C17H26/c1-7-12-10-13(16(2,3)4)11-15-14(12)8-9-17(15,5)6/h10-11H,7-9H2,1-6H3 |
| InChIKey | VVCREHFFZXVIAX-UHFFFAOYSA-N |
| Density | 0.898g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.414°C at 760 mmHg (Cal.) |
| Flash point | 106.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethyl-1,1-Dimethyl-6-(2-Methyl-2-Propanyl)Indane |