|
CAS#: 32510-27-3 Product: 2(3H)-Benzothiazolethione copper salt No suppilers available for the product. |
| Name | 2(3H)-Benzothiazolethione copper salt |
|---|---|
| Synonyms | Cuprous 1,3-Benzothiazole-2-Thiolate; 2(3H)-Benzothiazolethione, Copper Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4CuNS2 |
| Molecular Weight | 229.78 |
| CAS Registry Number | 32510-27-3 |
| EINECS | 251-074-8 |
| SMILES | [Cu+].C1=CC=CC2=C1N=C(S2)[S-] |
| InChI | 1S/C7H5NS2.Cu/c9-7-8-5-3-1-2-4-6(5)10-7;/h1-4H,(H,8,9);/q;+1/p-1 |
| InChIKey | OFEUSUWRXZHDRM-UHFFFAOYSA-M |
| Boiling point | 281.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 123.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2(3H)-Benzothiazolethione copper salt |