|
CAS#: 3254-66-8 Product: (4-Nitrophenyl) Dipropan-2-Yl Phosphate No suppilers available for the product. |
| Name | (4-Nitrophenyl) Dipropan-2-Yl Phosphate |
|---|---|
| Synonyms | Diisopropyl (4-Nitrophenyl) Phosphate; Phosphoric Acid Diisopropyl (4-Nitrophenyl) Ester; Diisopropyl Paraoxon |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18NO6P |
| Molecular Weight | 303.25 |
| CAS Registry Number | 3254-66-8 |
| SMILES | C1=CC(=CC=C1O[P](OC(C)C)(=O)OC(C)C)[N+]([O-])=O |
| InChI | 1S/C12H18NO6P/c1-9(2)17-20(16,18-10(3)4)19-12-7-5-11(6-8-12)13(14)15/h5-10H,1-4H3 |
| InChIKey | SHMLKFTUAKLHHF-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.047°C at 760 mmHg (Cal.) |
| Flash point | 173.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Nitrophenyl) Dipropan-2-Yl Phosphate |