|
CAS#: 32569-21-4 Product: Propan-2-Yl 2-Hydroxyethyl (E)-But-2-Enedioate No suppilers available for the product. |
| Name | Propan-2-Yl 2-Hydroxyethyl (E)-But-2-Enedioate |
|---|---|
| Synonyms | Isopropyl 2-Hydroxyethyl (E)-But-2-Enedioate; (E)-But-2-Enedioic Acid Isopropyl Ester 2-Hydroxyethyl Ester; 2-Hydroxyethyl Isopropyl Maleate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 32569-21-4 |
| EINECS | 251-100-8 |
| SMILES | C(O)COC(/C=C/C(=O)OC(C)C)=O |
| InChI | 1S/C9H14O5/c1-7(2)14-9(12)4-3-8(11)13-6-5-10/h3-4,7,10H,5-6H2,1-2H3/b4-3+ |
| InChIKey | HTZHJLUKEIMVLC-ONEGZZNKSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.314°C at 760 mmHg (Cal.) |
| Flash point | 116.123°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propan-2-Yl 2-Hydroxyethyl (E)-But-2-Enedioate |