|
CAS#: 3262-58-6 Product: (2S)-2-[[(2R)-2-(Carboxymethylamino)-3-Hydroxy-3-Oxopropyl]Amino]Butanedioic Acid No suppilers available for the product. |
| Name | (2S)-2-[[(2R)-2-(Carboxymethylamino)-3-Hydroxy-3-Oxopropyl]Amino]Butanedioic Acid |
|---|---|
| Synonyms | (2S)-2-[[(2R)-2-(Carboxymethylamino)-3-Hydroxy-3-Oxo-Propyl]Amino]Butanedioic Acid; (2S)-2-[[(2R)-2-(Carboxymethylamino)-3-Hydroxy-3-Keto-Propyl]Amino]Succinic Acid; Aspartic Acid, N-(2-Carboxy-2-((Carboxymethyl)Amino)Ethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N2O8 |
| Molecular Weight | 278.22 |
| CAS Registry Number | 3262-58-6 |
| SMILES | [C@@H](CN[C@H](C(=O)O)CC(=O)O)(C(=O)O)NCC(=O)O |
| InChI | 1S/C9H14N2O8/c12-6(13)1-4(8(16)17)10-2-5(9(18)19)11-3-7(14)15/h4-5,10-11H,1-3H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19)/t4-,5+/m0/s1 |
| InChIKey | FZCSTZYAHCUGEM-CRCLSJGQSA-N |
| Density | 1.599g/cm3 (Cal.) |
|---|---|
| Boiling point | 586.284°C at 760 mmHg (Cal.) |
| Flash point | 308.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-[[(2R)-2-(Carboxymethylamino)-3-Hydroxy-3-Oxopropyl]Amino]Butanedioic Acid |