|
CAS#: 32667-88-2 Product: (2S)-4-Methoxy-2-(Naphthalene-1-Carbonylamino)-4-Oxobutanoic Acid No suppilers available for the product. |
| Name | (2S)-4-Methoxy-2-(Naphthalene-1-Carbonylamino)-4-Oxobutanoic Acid |
|---|---|
| Synonyms | (2S)-4-Methoxy-2-(Naphthalene-1-Carbonylamino)-4-Oxo-Butanoic Acid; (2S)-4-Methoxy-2-[(1-Naphthyl-Oxomethyl)Amino]-4-Oxobutanoic Acid; (2S)-4-Keto-4-Methoxy-2-(Naphthalene-1-Carbonylamino)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 |
| CAS Registry Number | 32667-88-2 |
| SMILES | [C@@H](NC(C1=C2C(=CC=C1)C=CC=C2)=O)(C(=O)O)CC(=O)OC |
| InChI | 1S/C16H15NO5/c1-22-14(18)9-13(16(20)21)17-15(19)12-8-4-6-10-5-2-3-7-11(10)12/h2-8,13H,9H2,1H3,(H,17,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | NPGNCNZLRYJXRA-ZDUSSCGKSA-N |
| Density | 1.319g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.774°C at 760 mmHg (Cal.) |
| Flash point | 324.999°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-4-Methoxy-2-(Naphthalene-1-Carbonylamino)-4-Oxobutanoic Acid |