|
CAS#: 32695-20-8 Product: 2-Chloro-4-(Chloromethyl)-1-Propan-2-Yloxybenzene No suppilers available for the product. |
| Name | 2-Chloro-4-(Chloromethyl)-1-Propan-2-Yloxybenzene |
|---|---|
| Synonyms | 2-Chloro-4-(Chloromethyl)-1-Isopropoxy-Benzene; 2-Chloro-4-(Chloromethyl)-1-Isopropoxybenzene; 2-Chloro-4-(Chloromethyl)-1-Propan-2-Yloxy-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 |
| CAS Registry Number | 32695-20-8 |
| EINECS | 251-162-6 |
| SMILES | C1=C(C=CC(=C1Cl)OC(C)C)CCl |
| InChI | 1S/C10H12Cl2O/c1-7(2)13-10-4-3-8(6-11)5-9(10)12/h3-5,7H,6H2,1-2H3 |
| InChIKey | XZECPLIMOPAQFE-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.921°C at 760 mmHg (Cal.) |
| Flash point | 80.903°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-4-(Chloromethyl)-1-Propan-2-Yloxybenzene |