|
CAS#: 32745-55-4 Product: 1,4-Dihydro-1,4-Methanoanthracene-9,10-Dione No suppilers available for the product. |
| Name | 1,4-Dihydro-1,4-Methanoanthracene-9,10-Dione |
|---|---|
| Synonyms | 1,4-Methanoanthracene-9,10-Dione, 1,4-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 32745-55-4 |
| SMILES | C1=CC=CC4=C1C(C2=C(C3C=CC2C3)C4=O)=O |
| InChI | 1S/C15H10O2/c16-14-10-3-1-2-4-11(10)15(17)13-9-6-5-8(7-9)12(13)14/h1-6,8-9H,7H2 |
| InChIKey | UGTIHRDRMFXRLO-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.047°C at 760 mmHg (Cal.) |
| Flash point | 153.114°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dihydro-1,4-Methanoanthracene-9,10-Dione |