|
CAS#: 32786-66-6 Product: 4-Chloro-3,3,4-Trifluoro-N,N,2-Trimethyl-2-Butanamine No suppilers available for the product. |
| Name | 4-Chloro-3,3,4-Trifluoro-N,N,2-Trimethyl-2-Butanamine |
|---|---|
| Synonyms | 4-Chloro-3,3,4-trifluoro-N,N,2-trimethyl-2-butanamine # |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13ClF3N |
| Molecular Weight | 203.63 |
| CAS Registry Number | 32786-66-6 |
| SMILES | FC(F)(C(N(C)C)(C)C)C(Cl)F |
| InChI | 1S/C7H13ClF3N/c1-6(2,12(3)4)7(10,11)5(8)9/h5H,1-4H3 |
| InChIKey | WHXJQNRBAOXZBV-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 154.679°C at 760 mmHg (Cal.) |
| Flash point | 47.349°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-3,3,4-Trifluoro-N,N,2-Trimethyl-2-Butanamine |