|
CAS#: 32791-31-4 Product: (E)-2-Methyl-4-(2,6,6-Trimethyl-1-Cyclohexenyl)But-3-Enal No suppilers available for the product. |
| Name | (E)-2-Methyl-4-(2,6,6-Trimethyl-1-Cyclohexenyl)But-3-Enal |
|---|---|
| Synonyms | 2-Methyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)-3-Butenal; 3-Butenal, 2-Methyl-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 32791-31-4 |
| EINECS | 251-217-4 |
| SMILES | CC1=C(/C=C/C(C=O)C)C(CCC1)(C)C |
| InChI | 1S/C14H22O/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h7-8,10-11H,5-6,9H2,1-4H3/b8-7+ |
| InChIKey | HVDGAAPQCCUWDO-BQYQJAHWSA-N |
| Density | 0.935g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.94°C at 760 mmHg (Cal.) |
| Flash point | 133.368°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-2-Methyl-4-(2,6,6-Trimethyl-1-Cyclohexenyl)But-3-Enal |