Online Database of Chemicals from Around the World
|
CAS#: 32812-48-9 Product: 1,2-Bis(2-Chlorophenyl)-1-(Quinolin-2-Ylmethyl)Hydrazine No suppilers available for the product. |
| Name | 1,2-Bis(2-Chlorophenyl)-1-(Quinolin-2-Ylmethyl)Hydrazine |
|---|---|
| Synonyms | 1,2-Bis(2-Chlorophenyl)-1-(2-Quinolylmethyl)Hydrazine; Nsc137582 |
| Molecular Structure |  |
| Molecular Formula | C22H17Cl2N3 |
| Molecular Weight | 394.30 |
| CAS Registry Number | 32812-48-9 |
| SMILES | C4=CC(=C(NN(C1=C(Cl)C=CC=C1)CC3=NC2=C(C=CC=C2)C=C3)C=C4)Cl |
| InChI | 1S/C22H17Cl2N3/c23-18-8-2-5-11-21(18)26-27(22-12-6-3-9-19(22)24)15-17-14-13-16-7-1-4-10-20(16)25-17/h1-14,26H,15H2 |
| InChIKey | NFTOJQIZCOHWFF-UHFFFAOYSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.611°C at 760 mmHg (Cal.) |
| Flash point | 275.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(2-Chlorophenyl)-1-(Quinolin-2-Ylmethyl)Hydrazine |