|
CAS#: 32845-27-5 Product: Oxopurpureine No suppilers available for the product. |
| Name | Oxopurpureine |
|---|---|
| Synonyms | Smr000156318; Nsc141544; Oxopurpureine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 |
| CAS Registry Number | 32845-27-5 |
| SMILES | C1=C2C(=CC(=C1OC)OC)C(=O)C3=NC=CC4=C(C(=C(C2=C34)OC)OC)OC |
| InChI | 1S/C21H19NO6/c1-24-13-8-11-12(9-14(13)25-2)18(23)17-15-10(6-7-22-17)19(26-3)21(28-5)20(27-4)16(11)15/h6-9H,1-5H3 |
| InChIKey | AZTLZBDEFBJZQG-UHFFFAOYSA-N |
| Density | 1.305g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.255°C at 760 mmHg (Cal.) |
| Flash point | 313.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oxopurpureine |