|
CAS#: 329278-47-9 Product: 1-[(E)-Mesityldiazenyl]Piperidine No suppilers available for the product. |
| Name | 1-[(E)-Mesityldiazenyl]Piperidine |
|---|---|
| Synonyms | 1-(mesityldiazenyl)piperidine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 |
| CAS Registry Number | 329278-47-9 |
| SMILES | CC1=CC(=C(C(=C1)C)/N=N/N2CCCCC2)C |
| InChI | 1S/C14H21N3/c1-11-9-12(2)14(13(3)10-11)15-16-17-7-5-4-6-8-17/h9-10H,4-8H2,1-3H3/b16-15+ |
| InChIKey | LIZRTVBFKBGLCI-FOCLMDBBSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.0±52.0°C at 760 mmHg (Cal.) |
| Flash point | 169.7±30.7°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(E)-Mesityldiazenyl]Piperidine |