|
CAS#: 32939-57-4 Product: 4-Chloro-N-Hydroxy-N-(3-Methylphenyl)Benzamide No suppilers available for the product. |
| Name | 4-Chloro-N-Hydroxy-N-(3-Methylphenyl)Benzamide |
|---|---|
| Synonyms | Benzamide, 4-Chloro-N-Hydroxy-N-(3-Methylphenyl)-; N-3-Tolyl-4-Chlorobenzohydroxamic Acid; 3-Tcbha |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.71 |
| CAS Registry Number | 32939-57-4 |
| SMILES | C1=CC(=CC=C1C(=O)N(C2=CC=CC(=C2)C)O)Cl |
| InChI | 1S/C14H12ClNO2/c1-10-3-2-4-13(9-10)16(18)14(17)11-5-7-12(15)8-6-11/h2-9,18H,1H3 |
| InChIKey | IUSPLMKGDIOHFC-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.364°C at 760 mmHg (Cal.) |
| Flash point | 218.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-N-Hydroxy-N-(3-Methylphenyl)Benzamide |