|
CAS#: 3303-86-4 Product: 2,4,5-Trichlorophenyl N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-beta-Alaninate No suppilers available for the product. |
| Name | 2,4,5-Trichlorophenyl N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-beta-Alaninate |
|---|---|
| Synonyms | BOC-β-ALA-OTCP |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16Cl3NO4 |
| Molecular Weight | 368.64 |
| CAS Registry Number | 3303-86-4 |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)OC1=CC(=C(C=C1Cl)Cl)Cl |
| InChI | 1S/C14H16Cl3NO4/c1-14(2,3)22-13(20)18-5-4-12(19)21-11-7-9(16)8(15)6-10(11)17/h6-7H,4-5H2,1-3H3,(H,18,20) |
| InChIKey | ZADVZEPSEXEPQI-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 244.0±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Trichlorophenyl N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-beta-Alaninate |