|
CAS#: 33058-12-7 Product: Endrin alcohol No suppilers available for the product. |
| Name | Endrin alcohol |
|---|---|
| Synonyms | Nsc59452; Nsc122237 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl6O |
| Molecular Weight | 380.91 |
| CAS Registry Number | 33058-12-7 |
| SMILES | OC13C4C2(C5(C(C(C12Cl)(C6C3CC4C56)Cl)(Cl)Cl)Cl)Cl |
| InChI | 1S/C12H8Cl6O/c13-8-4-2-1-3-5(4)9(14,12(8,17)18)11(16)7(3,19)6(2)10(8,11)15/h2-6,19H,1H2 |
| InChIKey | FWIOOTDZGJSQMX-UHFFFAOYSA-N |
| Density | 2.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.695°C at 760 mmHg (Cal.) |
| Flash point | 224.558°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Endrin alcohol |