|
CAS#: 33086-27-0 Product: 1-(1-Cyclohexa-2,4-Dienylmethyl)-7-Thia-3,5-Diazabicyclo[4.1.0]Hepta-3,5-Dien-2-One No suppilers available for the product. |
| Name | 1-(1-Cyclohexa-2,4-Dienylmethyl)-7-Thia-3,5-Diazabicyclo[4.1.0]Hepta-3,5-Dien-2-One |
|---|---|
| Synonyms | Pyrimidinone, Dihydro(Phenylmethyl)Thioxo- (9Ci); Uracil, Benzylthio- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.27 |
| CAS Registry Number | 33086-27-0 |
| EINECS | 251-372-8 |
| SMILES | C(C12C(=NC=NC1=O)S2)C3CC=CC=C3 |
| InChI | 1S/C11H10N2OS/c14-9-11(10(15-11)13-7-12-9)6-8-4-2-1-3-5-8/h1-4,7-8H,5-6H2 |
| InChIKey | HVSIKZCKLATJAR-UHFFFAOYSA-N |
| Density | 1.448g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.142°C at 760 mmHg (Cal.) |
| Flash point | 164.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Cyclohexa-2,4-Dienylmethyl)-7-Thia-3,5-Diazabicyclo[4.1.0]Hepta-3,5-Dien-2-One |