|
CAS#: 33098-80-5 Product: N-(2,6-Dibromophenyl)Acetamide No suppilers available for the product. |
| Name | N-(2,6-Dibromophenyl)Acetamide |
|---|---|
| Synonyms | N-(2,6-Dibromophenyl)Ethanamide; 0-12-00-00659 (Beilstein Handbook Reference); 2,6-Dibromoacetanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Br2NO |
| Molecular Weight | 292.96 |
| CAS Registry Number | 33098-80-5 |
| SMILES | C1=C(C(=C(C=C1)Br)NC(C)=O)Br |
| InChI | 1S/C8H7Br2NO/c1-5(12)11-8-6(9)3-2-4-7(8)10/h2-4H,1H3,(H,11,12) |
| InChIKey | PNLHXEUNINMJFM-UHFFFAOYSA-N |
| Density | 1.891g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.264°C at 760 mmHg (Cal.) |
| Flash point | 183.777°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,6-Dibromophenyl)Acetamide |