|
CAS#: 33103-47-8 Product: 1,4,5,5,6,6-Hexafluoro-2,3-Dimethylbicyclo[2.2.0]Hex-2-Ene No suppilers available for the product. |
| Name | 1,4,5,5,6,6-Hexafluoro-2,3-Dimethylbicyclo[2.2.0]Hex-2-Ene |
|---|---|
| Synonyms | 1,4,5,5,6,6-Hexafluoro-2,3-dimethylbicyclo[2.2.0]hex-2-ene # |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6F6 |
| Molecular Weight | 216.12 |
| CAS Registry Number | 33103-47-8 |
| SMILES | FC2(F)C1(F)/C(=C(\C1(F)C2(F)F)C)C |
| InChI | 1S/C8H6F6/c1-3-4(2)6(10)5(3,9)7(11,12)8(6,13)14/h1-2H3 |
| InChIKey | ZZIIKPOSXGWMMR-UHFFFAOYSA-N |
| Density | 1.446g/cm3 (Cal.) |
|---|---|
| Boiling point | 89.014°C at 760 mmHg (Cal.) |
| Flash point | 13.341°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,5,5,6,6-Hexafluoro-2,3-Dimethylbicyclo[2.2.0]Hex-2-Ene |