|
CAS#: 3312-83-2 Product: Di(Phenyl)Methyl N-Diazocarbamate No suppilers available for the product. |
| Name | Di(Phenyl)Methyl N-Diazocarbamate |
|---|---|
| Synonyms | N-Diazocarbamic Acid Di(Phenyl)Methyl Ester; Carbonazidic Acid, Diphenylmethyl Ester; Formic Acid, Azido-, Diphenylmethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 |
| CAS Registry Number | 3312-83-2 |
| SMILES | N(C(OC(C1=CC=CC=C1)C2=CC=CC=C2)=O)=[N+]=[N-] |
| InChI | 1S/C14H11N3O2/c15-17-16-14(18)19-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | HTNFWNXJCKRKTG-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Di(Phenyl)Methyl N-Diazocarbamate |